L-Tyrosine-[d3]
L-Tyrosine-[d3] is a deuterium labelled analogue of L-Tyrosine. L-Tyrosine is a non-essential amino acid and one of the 22 amino acids used in the synthesis of protein. It is derived from phenylalanine in human body and abundant in high-protein food products.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-009557 |
| Pricing | Inquire |
| Cas | 71939-39-4 |
| Molecular Weight | 184.21 |
| Molecular Formula | C9H8D3NO3 |
| Canonical SMILES | C1=CC(=CC=C1CC(C(=O)O)N)O |