[2-[[2,3,6-Tri-O-acetyl-4-O-(2,3,4,6-tetra-O-acetyl-b-D-glucopyranosyl)-b-D-glucopyranosyl]oxy]ethyl]-carbamic acid phenylmethyl ester
2-[[2,3,6-Tri-O-acetyl-4-O-(2,3,4,6-tetra-O-acetyl-b-D-glucopyranosyl)-b-D-glucopyranosyl]oxy]ethyl]-carbamic acid phenylmethyl ester is an experimental pharmaceutical compound. Its unique molecular structure may have potential in the development of novel treatments for diabetes due to its glucopyranosyl components.
| Supplier | BOC Sciences |
|---|---|
| Product # | 64448-40-4 |
| Pricing | Inquire |
| Cas | 64448-40-4 |
| Molecular Weight | 813.8 |
| Molecular Formula | C36H47NO20 |
| Canonical SMILES | CC(=O)OCC1C(C(C(C(O1)OCCNC(=O)OCC2=CC=CC=C2)OC(=O)C)OC(=O)C)OC3C(C(C(C(O3)COC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C |