N4-Benzoyl-3 ,5 -O-(1,1,3,3-tetraisopropyl-1,3-disiloxanediyl)cytidine
N4-Benzoyl-3,5-O-(1,1,3,3-tetraisopropyl-1,3-disiloxanediyl)cytidine, a formidable biomedical agent, stands as a beacon of hope in the realm of viral infection treatment. Acutely attuned to cytidine-sensitive viruses, this compound, hailing from the prestigious nucleoside analog drug family, adroitly disrupts the replication mechanism ensnaring the targeted foes.
| Supplier | BOC Sciences |
|---|---|
| Product # | 69304-43-4 |
| Pricing | Inquire |
| Cas | 69304-43-4 |
| Molecular Weight | 589.83 |
| Molecular Formula | C28H43N3O7Si2 |
| Canonical SMILES | CC(C)[Si]1(OCC2C(C(C(O2)N3C=CC(=NC3=O)NC(=O)C4=CC=CC=C4)O)O[Si](O1)(C(C)C)C(C)C)C(C)C |