SCH-1473759
SCH-1473759 is a novel sub-nanomolar Aurora A/B inhibitor. SCH 1473759 was active against a large panel of tumor cell lines from different tissue origin and genetic backgrounds. SCH-1473759 demonstrated potent mechanism-based activity, and activity was shown to be enhanced in combination with taxanes and KSP inhibitors.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1094069-99-4 |
| Pricing | Inquire |
| Cas | 1094069-99-4 |
| Molecular Weight | 426.54 |
| Molecular Formula | C20H26N8OS |
| Canonical SMILES | CCN(CC1=NSC(=C1)NC2=NC(=CN3C2=NC=C3C4=CNN=C4)C)C(C)(C)CO |