4-Nitrophenyl b-D-thiogalactopyranoside
4-Nitrophenyl b-D-thiogalactopyranoside is a biochemical recompound used for the detection of β-galactosidase activity in various biological assays. It is commonly utilized for monitoring gene expression and protein localization in cellular and molecular biology research. This compound acts as a substrate for β-galactosidase, resulting in conveniently quantifying enzyme activity.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1230-27-9 |
| Pricing | Inquire |
| Cas | 1230-27-9 |
| Molecular Weight | 317.32 |
| Molecular Formula | C12H15NO7S |
| Canonical SMILES | C1=CC(=CC=C1[N+](=O)[O-])SC2C(C(C(C(O2)CO)O)O)O |