Cyclic di-GMP sodium salt
Cyclic di-GMP is a second messenger in bacteria, which is involved in diverse prokaryotic processes, including biofilm formation, motility, virulence, and cell cycling. Cyclic di-GMP induces expression of IFN-β mRNA in vitro (EC50 = 537.8 nM) but less potently than 2'3'-cGAMP, 3'2'-cGAMP, 3'3'-cGAMP, and 2'2'-cGAMP.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2222132-40-1 |
| Pricing | Inquire |
| Cas | 2222132-40-1 |
| Molecular Weight | 734.37 |
| Molecular Formula | C20H22N10Na2O14P2 |
| Canonical SMILES | C1C2C(C(C(O2)N3C=NC4C3=NC(=N)NC4=O)O)OP(=O)(OCC5C(C(C(O5)N6C=NC7C6=NC(=N)NC7=O)O)OP(=O)(O1)[O-])[O-].[Na+].[Na+] |