Phenylacetic acid mustard
Phenylacetic Mustard is a nitrogen mustard analog and the active metabolite of Chlorambucil. It is used as a chemotherapeutic agent and aside from having clastogenic activity, it can also induce chromosome delay.
| Supplier | BOC Sciences |
|---|---|
| Product # | 10477-72-2 |
| Pricing | Inquire |
| Cas | 10477-72-2 |
| Molecular Weight | 276.16 |
| Molecular Formula | C12H15Cl2NO2 |
| Canonical SMILES | C1=CC(=CC=C1CC(=O)O)N(CCCl)CCCl |