Triciribine phosphate-[13C,d3]
Triciribine phosphate-[13C,d3] is the labelled phosphate salt of Tricirbine. Triciribine is a tricyclic nucleoside that inhibits the phosphorylation, activation, and signalling of Akt- Akt-1, Akt-2 and Akt-3. Triciribine is currently under studies of breast cancer and ovarian cancer as an antineoplastic.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-007512 |
| Pricing | Inquire |
| Molecular Weight | 404.29 |
| Molecular Formula | C12[13C]H14D3N6O7P |
| Canonical SMILES | CN1C2=NC=NC3=C2C(=CN3C4C(C(C(O4)COP(=O)(O)O)O)O)C(=N1)N |