Amythiamicin D
It is produced by the strain of Amycolatopsis sp. M481-42F4. It has activity against gram-positive bacteria including Multidrug resistant Staphylococcus aureus and Methicillin-resistant Staphylococcus aureus (MR-SA)(MIC 0.1-0.78μg/mL). Not resistant to gram-negative bacteria and fungi.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-00463 |
| Pricing | Inquire |
| Cas | 156620-46-1 |
| Molecular Weight | 1031.26 |
| Molecular Formula | C43H42N12O7S6 |
| Canonical SMILES | CC1=C2C(=O)NC(C3=NC(=CS3)C(=O)NCC(=O)NC(C4=NC(=CS4)C5=NC(=CS5)C6=C(C=CC(=N6)C7=NC(=CS7)C(=O)OC)C8=NC(=CS8)C(=O)NC(C(=N2)S1)CC(=O)NC)C(C)C)C(C)C |