1-Methylindazole-4-boronic acid pinacol ester
1-Methylindazole-4-boronic acid pinacol ester is a pharmaceutical intermediate used in the synthesis of various drug molecules. In biomedicine, it serves as a key component in cancer therapeutics development due to its boronic acid functionality.
| Supplier | BOC Sciences |
|---|---|
| Product # | 885698-94-2 |
| Pricing | Inquire |
| Cas | 885698-94-2 |
| Molecular Weight | 258.127 |
| Molecular Formula | C14H19BN2O2 |
| Canonical SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C3C=NN(C3=CC=C2)C |