3,6-Dichloropyridazine-4-carboxylic acid
3,6-Dichloropyridazine-4-carboxylic acid (CAS# 51149-08-7) is a new heterocyclic building block, used in the synthesis of more complex pharmaceutical and biologically active compounds. It can be used in the synthesis of fused [1,2,4]triazolo[4,3-b]pyridazine derivatives, possessing significant antibacterial and antifungal activity.
| Supplier | BOC Sciences |
|---|---|
| Product # | 51149-08-7 |
| Pricing | Inquire |
| Cas | 51149-08-7 |
| Molecular Weight | 192.99 |
| Molecular Formula | C5H2Cl2N2O2 |
| Canonical SMILES | C1=C(C(=NN=C1Cl)Cl)C(=O)O |