cyclic Isopropylidene 1,1-cyclopropanedicarboxylate
cyclic Isopropylidene 1,1-cyclopropanedicarboxylate (CAS# 5617-70-9) is used as a reagent to synthesize Bis-benzimidazoles, compounds that act as inhibitors of Type II Dihydrofolate reductase (an enzyme that is produced by bacteria in response to Trimethoprim [T795615]as a defense mechanism).
| Supplier | BOC Sciences |
|---|---|
| Product # | 5617-70-9 |
| Pricing | Inquire |
| Cas | 5617-70-9 |
| Molecular Weight | 170.16 |
| Molecular Formula | C8H10O4 |
| Canonical SMILES | CC1(OC(=O)C2(CC2)C(=O)O1)C |