3'-Deoxy-3'-fluoro-5-methyl-xylo-uridine
3'-Deoxy-3'-fluoro-5-methyl-xylo-uridine, a formidable antiviral compound employed in the biomedical sector, displays remarkable efficacy in combatting an array of viral afflictions such as influenza and herpes. Its mechanism entails impeding viral replication, thereby thwarting the dissemination of the virus and mitigating subsequent detrimental consequences.
| Supplier | BOC Sciences |
|---|---|
| Product # | 917110-29-3 |
| Pricing | Inquire |
| Cas | 917110-29-3 |
| Molecular Weight | 260.22 |
| Molecular Formula | C10H13FN2O5 |
| Canonical SMILES | CC1=CN(C(=O)NC1=O)C2C(C(C(O2)CO)F)O |