Perfluorooctanoic acid
Applications: Pentadecafluorooctanoic Acid is used to produce fluoropolymers. Studies showed that Pentadecafluorooctanoic Acid exhibits a long half-life in human blood and interferes with the binding between liver-fatty acid binding protein and fatty acids. Pentadecafluorooctanoic Acid also induce hepatic peroxisome proliferation in rodents.Dangerous Goods Info: Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package.
| Supplier | BOC Sciences |
|---|---|
| Product # | 335-67-1 |
| Pricing | Inquire |
| Cas | 335-67-1 |
| Molecular Weight | 414.07 |
| Molecular Formula | C8HF15O2 |
| Canonical SMILES | C(=O)(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)O |