Malachite Green-[d5]
Malachite Green-[d5] is the labelled analogue of Malachite green, which is a triphenylmethane dye. It has a role as a fluorochrome, an antifungal drug, a carcinogenic agent, a teratogenic agent and an antibacterial agent.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-004644 |
| Pricing | Inquire |
| Molecular Weight | 369.94 |
| Molecular Formula | C23H20D5ClN2 |
| Canonical SMILES | CN(C)C1=CC=C(C=C1)C(=C2C=CC(=[N+](C)C)C=C2)C3=CC=CC=C3.[Cl-] |