1-O-Acetyl-2,3,5-tri-O-p-chlorobenzoyl-b-D-ribofuranose
1-O-Acetyl-2,3,5-tri-O-p-chlorobenzoyl-b-D-ribofuranose is a crucial compound employed in the biomedical industry. It acts as a precursor for the synthesis of chemotherapeutic drugs used in the treatment of various diseases. Its unique structure allows for targeted drug delivery.
| Supplier | BOC Sciences |
|---|---|
| Product # | 144084-01-5 |
| Pricing | Inquire |
| Cas | 144084-01-5 |
| Molecular Weight | 607.82 |
| Molecular Formula | C28H21Cl3O9 |
| Canonical SMILES | CC(=O)OC1C(C(C(O1)COC(=O)C2=CC=C(C=C2)Cl)OC(=O)C3=CC=C(C=C3)Cl)OC(=O)C4=CC=C(C=C4)Cl |