Nemonoxacin
Nemonoxacin is a broad-spectrum antibiotic belonging to the quinolone class. Nemonoxacin works by inhibiting bacterial DNA gyrase and topoisomerase IV enzymes, which are essential for bacterial DNA replication, transcription, repair, and recombination. By interfering with these processes, it effectively kills bacteria. Nemonoxacin is primarily used to treat various bacterial infections, including those caused by Gram-positive and Gram-negative bacteria. It is particularly effective against pathogens such as Staphylococcus aureus, Streptococcus pneumoniae, Haemophilus influenzae, and various Enterobacteriaceae.
| Supplier | BOC Sciences |
|---|---|
| Product # | 378746-64-6 |
| Pricing | Inquire |
| Cas | 378746-64-6 |
| Molecular Weight | 371.43 |
| Molecular Formula | C20H25N3O4 |
| Canonical SMILES | CC1CC(CN(C1)C2=C(C3=C(C=C2)C(=O)C(=CN3C4CC4)C(=O)O)OC)N |