Regorafenib monohydrate impurity B [EP]
An impurity of Regorafenib. Regorafenib is a multi-kinase inhibitor which targets angiogenic, stromal and oncogenic receptor tyrosine kinase. It shows anti-angiogenic activity due to its dual targeted VEGFR2-TIE2 tyrosine kinase inhibition.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2141961-84-2 |
| Pricing | Inquire |
| Cas | 2141961-84-2 |
| Molecular Weight | 303.29 |
| Molecular Formula | C15H14FN3O3 |
| Canonical SMILES | CC(=O)NC1=C(C=C(C=C1)OC2=CC(=NC=C2)C(=O)NC)F |