7-Hydroxy Quetiapine-[d8]
7-Hydroxy Quetiapine-[d8] is the labelled analogue of 7-Hydroxy Quetiapine, which is a metabolite of Quetiapine. Quetiapine is an atypical antipsychotic used for the treatment of schizophrenia, bipolar disorder and major depressive disorder.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-007917 |
| Pricing | Inquire |
| Cas | 1185098-57-0 |
| Molecular Weight | 407.56 |
| Molecular Formula | C21H17D8N3O3S |
| Canonical SMILES | C1CN(CCN1CCOCCO)C2=NC3=C(C=C(C=C3)O)SC4=CC=CC=C42 |