2-Oxopomolic acid
2-Oxopomolic Acid is a natural compound that has garnered significant attention within the research of biomedical research due to its remarkable anti-inflammatory and anticancer properties. This natural compound is admired for its extraordinary capabilities exhibiting an unprecedented ability to hinder the production of pro-inflammatory cytokines.
| Supplier | BOC Sciences |
|---|---|
| Product # | NP6510 |
| Pricing | Inquire |
| Cas | 54963-52-9 |
| Molecular Weight | 486.68 |
| Molecular Formula | C30H46O5 |
| Canonical SMILES | CC1CCC2(CCC3(C(=CCC4C3(CCC5C4(CC(=O)C(C5(C)C)O)C)C)C2C1(C)O)C)C(=O)O |