ZM 39923 HCl
ZM 39923 HCl is a potent and selective inhibitor of JAK3, and also inhibits EGFR, JAK1 and CDK4. It breaks down in neutral buffer (t½ = 36 mins, pH 7.43, 25°C) to form ZM 449829.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1021868-92-7 |
| Pricing | Inquire |
| Cas | 1021868-92-7 |
| Molecular Weight | 367.91 |
| Molecular Formula | C23H25NO.HCl |
| Canonical SMILES | CC(C)N(CCC(=O)C1=CC2=CC=CC=C2C=C1)CC3=CC=CC=C3.Cl |