2-(2, 5-Dihydroxyphenyl)benzene-1, 4-Diol
2-(2, 5-Dihydroxyphenyl)benzene-1, 4-Diol is an influential compound extensively employed in studying a myriad of ailments and disorders such as specific cancers and neurodegenerative conditions. Moreover, this compound demonstrates notable antioxidant and anti-inflammatory properties.
| Supplier | BOC Sciences |
|---|---|
| Product # | 4371-32-8 |
| Pricing | Inquire |
| Cas | 4371-32-8 |
| Molecular Weight | 218.21 |
| Molecular Formula | C12H10O4 |
| Canonical SMILES | C1=CC(=C(C=C1O)C2=C(C=CC(=C2)O)O)O |