5'-O-Acetyl-2',3'-dideoxy-2',3'-didehydro-5-fluoro-uridine
5'-O-Acetyl-2',3'-dideoxy-2',3'-didehydro-5-fluoro-uridine is a potent antiviral compound used in the research of various viral infections, including hepatitis B and HIV. This compound inhibits viral replication by targeting the viral reverse transcriptase enzyme, effectively impeding the enhancement of viral DNA. Additionally, it displays selective toxicity towards infected cells, making it an invaluable tool in antiviral therapy research and drug development.
| Supplier | BOC Sciences |
|---|---|
| Product # | 160203-74-7 |
| Pricing | Inquire |
| Cas | 160203-74-7 |
| Molecular Weight | 270.21 |
| Molecular Formula | C11H11FN2O5 |
| Canonical SMILES | CC(=O)OCC1C=CC(O1)N2C=C(C(=O)NC2=O)F |