Pemetrexed Impurity 8
Pemetrexed Impurity 8 is one of pemetrexed impurities. Pemetrexed binds to and inhibits the enzyme thymidylate synthase (TS) which catalyses the methylation of 2'-deoxyuridine-5'-monophosphate (dUMP) to 2'-deoxythymidine-5'-monophosphate (dTMP), an essential precursor in DNA synthesis.
| Supplier | BOC Sciences |
|---|---|
| Product # | 155405-79-1 |
| Pricing | Inquire |
| Cas | 155405-79-1 |
| Molecular Weight | 285.13 |
| Molecular Formula | C12H13BrO3 |
| Canonical SMILES | COC(=O)C1=CC=C(C=C1)CCC(C=O)Br |