Cephapirin benzathine
Cephapirin benzathine is a first-generation cephalosporin with a broad spectrum of activity against gram-positive and gram-negative organisms. Its resistance to β-lactamase is higher than that of the penicillin family. commonly used in the veterinary field.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-04147 |
| Pricing | Inquire |
| Cas | 97468-37-6 |
| Molecular Weight | 1087.27 |
| Molecular Formula | C50H54N8O12S4 |
| Canonical SMILES | CC(=O)OCC1=C(N2C(C(C2=O)NC(=O)CSC3=CC=NC=C3)SC1)C(=O)O.CC(=O)OCC1=C(N2C(C(C2=O)NC(=O)CSC3=CC=NC=C3)SC1)C(=O)O.C1=CC=C(C=C1)CNCCNCC2=CC=CC=C2 |