N4-Acetyl-3',5'-O-(1,1,3,3-tetraisopropyl-1,3-disiloxanediyl)cytidine
N4-Acetyl-3',5'-O-(1,1,3,3-tetraisopropyl-1,3-disiloxanediyl)cytidine, a remarkable biomedical entity, exhibits profound efficacy in addressing specific ailments and pathologies. In the realm of biomedicine, this compound has garnered immense attention owing to its auspicious implications in the synthesis of antiviral agents and nucleoside analogs targeting diverse viral afflictions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 85335-73-5 |
| Pricing | Inquire |
| Cas | 85335-73-5 |
| Molecular Weight | 527.76 |
| Molecular Formula | C23H41N3O7Si2 |
| Canonical SMILES | CC(C)[Si]1(OCC2C(C(C(O2)N3C=CC(=NC3=O)NC(=O)C)O)O[Si](O1)(C(C)C)C(C)C)C(C)C |