9-(b-D-Xylofuranosyl)guanine
9-(β-D-Xylofuranosyl)guanine, a renowned biomedicine product, is widely recognized for its efficaciousness in combating viral infections, particularly those induced by herpes viruses. Functioning as an antiviral agent, this compound effectively hinders the proliferation of viral DNA, thereby mitigating viral burden and alleviating symptoms related to herpes virus infections.
| Supplier | BOC Sciences |
|---|---|
| Product # | 27462-39-1 |
| Pricing | Inquire |
| Cas | 27462-39-1 |
| Molecular Weight | 283.24 |
| Molecular Formula | C10H13N5O5 |
| Canonical SMILES | C1=NC2=C(N1C3C(C(C(O3)CO)O)O)N=C(NC2=O)N |