Apigeninidin chloride
Apigeninidin (Gesneridin) is a chemical compound belonging to the 3-deoxyanthocyanidins and that was found in the Patagonian plant Ephedra frustillata and in the soybean. Apigeninidin is one of the principal pigments found in sorghum. Apigeninidin has antibiotic and antifungal properties.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1151-98-0 |
| Pricing | Inquire |
| Cas | 1151-98-0 |
| Molecular Weight | 290.7 |
| Molecular Formula | C15H11O4·Cl |
| Canonical SMILES | C1=CC(=CC=C1C2=[O+]C3=CC(=CC(=C3C=C2)O)O)O.[Cl-] |