Pemetrexed Impurity 37
Pemetrexed Impurity 37 is one of pemetrexed impurities. Pemetrexed binds to and inhibits the enzyme thymidylate synthase (TS) which catalyses the methylation of 2'-deoxyuridine-5'-monophosphate (dUMP) to 2'-deoxythymidine-5'-monophosphate (dTMP), an essential precursor in DNA synthesis.
| Supplier | BOC Sciences |
|---|---|
| Product # | 151864-81-2 |
| Pricing | Inquire |
| Cas | 151864-81-2 |
| Molecular Weight | 206.24 |
| Molecular Formula | C12H14O3 |
| Canonical SMILES | CCOC(=O)C1=CC=C(C=C1)CCC=O |