6-Amino-3,3-dimethylindolin-2-one
6-Amino-3,3-dimethylindolin-2-one (CAS# 100510-65-4) is a versatile reactant used in the preparation of selective and potent aminoisoquinoline derivatives as inhibitors of mutant B-Raf pathway. It is also used in the synthesis of pentacyclic aurora kinase inhibitors.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB000243 |
| Pricing | Inquire |
| Cas | 100510-65-4 |
| Molecular Weight | 176.22 |
| Molecular Formula | C10H12N2O |
| Canonical SMILES | CC1(C2=C(C=C(C=C2)N)NC1=O)C |