2'-Deoxy-5'-DMT-5-ethenyluridine 3'-CE phosphoramidite
2'-Deoxy-5'-DMT-5-ethenyluridine 3'-CE phosphoramidite is a critical and widely used biochemical reagent in the biomedicine industry. Its primary function is to aid in the synthesis of RNA oligonucleotides needed for various research purposes, including the development of therapeutic oligonucleotides that target specific genetic disorders. Moreover, it serves as a fundamental tool for exploring the chemical modification of RNA molecules and its impact on different biological processes. Its significance in the biomedicine industry cannot be overstated.
| Supplier | BOC Sciences |
|---|---|
| Product # | 287980-24-9 |
| Pricing | Inquire |
| Cas | 287980-24-9 |
| Molecular Weight | 756.8 |
| Molecular Formula | C41H49N4O8P |
| Canonical SMILES | CC(C)N(C(C)C)P(OCCC#N)OC1CC(OC1COC(C2=CC=CC=C2)(C3=CC=C(C=C3)OC)C4=CC=C(C=C4)OC)N5C=C(C(=O)NC5=O)C=C |