5'-O-DMT-thymidine-3'-O-succinic acid
5'-O-DMT-thymidine-3'-O-succinic acid, an indispensable compound extensively employed in the biomedical sector for versatile applications, exhibits its profound significance. Functioning as a pivotal precursor in antiviral drug synthesis, it selectively combats RNA and DNA viruses. Additionally, it remarkably contributes to the advancement of pharmaceuticals dedicated to the treatment of HIV, hepatitis, and cancer.
| Supplier | BOC Sciences |
|---|---|
| Product # | 74405-40-6 |
| Pricing | Inquire |
| Cas | 74405-40-6 |
| Molecular Weight | 644.67 |
| Molecular Formula | C35H36N2O10 |
| Canonical SMILES | CC1=CN(C(=O)NC1=O)C2CC(C(O2)COC(C3=CC=CC=C3)(C4=CC=C(C=C4)OC)C5=CC=C(C=C5)OC)OC(=O)CCC(=O)O |