Acecainide HCl
Acecainide, also known as N-acetylprocainamide and ASL 601, is a class III antiarrhythmic compound. It increases the duration of the action potential by decreasing the delayed outward potassium current, slightly decreasing the calcium current, and slightly depressing the inward rectifier potassium current. Acecainide can be given either intravenously or orally, and is eliminated primarily by renal excretion.
| Supplier | BOC Sciences |
|---|---|
| Product # | B0046-109971 |
| Pricing | Inquire |
| Cas | 34118-92-8 |
| Molecular Weight | 313.82 |
| Molecular Formula | C15H24ClN3O2 |
| Canonical SMILES | CC(NC1=CC=C(C(NCCN(CC)CC)=O)C=C1)=O.[H]Cl |