1, 8-Dinitropyrene
A derivative of Pyrene. Pyrene is a polycyclic aromatic hydrocarbon consisting of four fused benzene rings, resulting in a flat aromatic system. Pyrene occurs in coal tar. Also obtained by the destructive hydrogenation of hard coal.
| Supplier | BOC Sciences |
|---|---|
| Product # | 42397-65-9 |
| Pricing | Inquire |
| Cas | 42397-65-9 |
| Molecular Weight | 292.25 |
| Molecular Formula | C16H8N2O4 |
| Canonical SMILES | C1=CC2=C3C(=C(C=C2)[N+](=O)[O-])C=CC4=C(C=CC1=C43)[N+](=O)[O-] |