2-(4-Chloro-2-methoxy-6-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
2-(4-Chloro-2-methoxy-6-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane is an intermediate in the preparation of B-(4-Chloro-2-hydroxy-6-methylphenyl)boronic Acid (CAT# C231800), which can be useful in the preparation of orally bioavailable pyrrolodinopyrimidine- containing inhibitors of heat shock protein 90 (Hsp90) as potential antitumor agents.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB070450 |
| Pricing | Inquire |
| Cas | 1207961-49-6 |
| Molecular Weight | 282.57 |
| Molecular Formula | C14H20BClO3 |
| Canonical SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2C)Cl)OC |