6-FAM-DMT-phosphoramidite
6-FAM-DMT Phosphoramidite is a phosphoramidite derivative used to introduce 6-carboxyfluorescein (6-FAM) into oligonucleotides during solid-phase synthesis. It includes a 6-FAM fluorophore and a dimethoxytrityl (DMT) protecting group, which facilitates efficient incorporation and subsequent deprotection during synthesis. This reagent enables the production of fluorescently labeled oligonucleotides for applications such as fluorescence-based detection, quantitative PCR (qPCR), and fluorescence resonance energy transfer (FRET) assays.
Supplier | BOC Sciences |
---|---|
Product # | 316121-60-5 |
Pricing | Inquire |
Cas | 316121-60-5 |
Molecular Weight | 1176.33 |
Molecular Formula | C68H78N3O13P |
Canonical SMILES | COC1=CC=C(C=C1)C(OCC(CCCCNC(=O)C1=CC=C2C(=O)OC3(C2=C1)C1=CC=C(OC(=O)C(C)(C)C)C=C1OC1=CC(OC(=O)C(C)(C)C)=CC=C31)COP(OCCC#N)N(C(C)C)C(C)C)(C1=CC=CC=C1)C1=CC=C(OC)C=C1 |