10,11-Dihydro-10-hydroxycarbamazepine O-b-D-glucuronide
10,11-Dihydro-10-hydroxycarbamazepine O-b-D-glucuronide, a prominent biomedical agent, finds utilization in addressing the debilitating conditions of epilepsy and neuropathic pain. Notably, its role as a consequential metabolite of the esteemed antiepileptic medication carbamazepine necessitates recognition. Profoundly influential in the sphere of drug metabolism and pharmacokinetics, this glucuronide conjugate assumes a pivotal responsibility in eliminating carbamazepine from the bodily system. Thus, its significance reverberates within the scientific community.
| Supplier | BOC Sciences |
|---|---|
| Product # | 144407-84-1 |
| Pricing | Inquire |
| Cas | 144407-84-1 |
| Molecular Weight | 430.41 |
| Molecular Formula | C21H22N2O8 |
| Canonical SMILES | C1C(C2=CC=CC=C2N(C3=CC=CC=C31)C(=O)N)OC4C(C(C(C(O4)C(=O)O)O)O)O |