Fluorene-1-carboxylic acid
Fluorene-1-carboxylic acid (CAS# 6276-03-5) is an intermediate used in the synthesis of Fluoren-1-ol (F462450), which is a metabolite of the PAH micropollutant Fluorene (F462002) with potential mutagenic effects. It is used as biomarkers to evaluate exposure to PAHs and environmental tobacco smoke in general population. Also, it possesses interface electronic properties. Achiral fluorescent agent.
| Supplier | BOC Sciences |
|---|---|
| Product # | 6276-03-5 |
| Pricing | Inquire |
| Cas | 6276-03-5 |
| Molecular Weight | 210.23 |
| Molecular Formula | C14H10O2 |
| Canonical SMILES | C1C2=CC=CC=C2C3=C1C(=CC=C3)C(=O)O |