Verapamil Impurity A DiHCl
An impurity of Verapamil. Verapamil is a medication used for the treatment of high blood pressure, chest pain from not enough blood flow to the heart, and supraventricular tachycardia.
| Supplier | BOC Sciences |
|---|---|
| Product # | 63434-11-7 |
| Pricing | Inquire |
| Cas | 63434-11-7 |
| Molecular Weight | 503.51 |
| Molecular Formula | C25H38N2O4. 2 HCl |
| Canonical SMILES | CN(CCCN(C)CCC1=CC(=C(C=C1)OC)OC)CCC2=CC(=C(C=C2)OC)OC.Cl.Cl |