4-(Methylnitrosamino)-1-(3-pyridyl)-1-butanone
4-(Methylnitrosamino)-1-(3-pyridyl)-1-butanone is a nicotine-nitrosated derivative. It binds to the nicotinic acetylcholine receptor topromote tumor growth by enhancing and deregulating cell proliferation, survival, migration, and invasion, thereby creating a microenvironment for tumor growth.
| Supplier | BOC Sciences |
|---|---|
| Product # | 64091-91-4 |
| Pricing | Inquire |
| Cas | 64091-91-4 |
| Molecular Weight | 207.23 |
| Molecular Formula | C10H13N3O2 |
| Canonical SMILES | CN(CCCC(=O)C1=CN=CC=C1)N=O |