5'-Deoxy-5'-fluoro-5'-(methylthio)adenosine
5'-Deoxy-5'-fluoro-5'-(methylthio)adenosine, a compound of utmost importance in the biomedicine industry, assumes a pivotal position in the advancement of pharmaceuticals intended to combat an array of ailments, including cancer and viral infections. Its multifaceted attributes and specific configuration render it an imperative entity vital for targeted drug administration and an integral constituent within antiviral therapeutic measures.
| Supplier | BOC Sciences |
|---|---|
| Product # | 119771-21-0 |
| Pricing | Inquire |
| Cas | 119771-21-0 |
| Molecular Weight | 315.33 |
| Molecular Formula | C11H14FN5O3S |
| Canonical SMILES | CSC(C1C(C(C(O1)N2C=NC3=C(N=CN=C32)N)O)O)F |