Citalopram-[d4]
Citalopram-[d4], is the labelled analogue of Citalopram. Citalopram is an antidepressant of the selective serotonin reuptake inhibitor class. It is used to treat major depressive disorder, obsessive compulsive disorder, panic disorder, and social phobia.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-002281 |
| Pricing | Inquire |
| Cas | 1219908-84-5 |
| Molecular Weight | 328.39 |
| Molecular Formula | C20H17D4FN2O |
| Canonical SMILES | CN(C)CCCC1(C2=C(CO1)C=C(C=C2)C#N)C3=CC=C(C=C3)F |