Berberine chloride monohydrate
Berberine chloride hydrate is a natural compound derived from plants like barberry. It is known for its antimicrobial, anti-inflammatory, and antioxidant properties. It may also help regulate blood sugar levels, improve lipid metabolism, and support heart health. This compound is commonly used in dietary supplements and traditional medicine for its various health benefits.
| Supplier | BOC Sciences |
|---|---|
| Product # | 68030-18-2 |
| Pricing | Inquire |
| Cas | 68030-18-2 |
| Molecular Weight | 389.83 |
| Molecular Formula | C20H20ClNO5 |
| Canonical SMILES | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC5=C(C=C4CC3)OCO5)OC.O.[Cl-] |