5-O-Trityl-D-ribose
5-O-Trityl-D-ribose is a vital compound utilized in biomedical research. It serves as a key building block in the synthesis of nucleosides and nucleotides for anti-viral and anti-cancer drug development. Its availability in the market supports advancements in biomedicine research and therapeutic strategies.
| Supplier | BOC Sciences |
|---|---|
| Product # | 53225-58-4 |
| Pricing | Inquire |
| Cas | 53225-58-4 |
| Molecular Weight | 392.4 |
| Molecular Formula | C24H24O5 |
| Canonical SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)OCC4C(C(C(O4)O)O)O |