4',5'-Didehydro-2',5'-dideoxyuridine
4',5'-Didehydro-2',5'-dideoxyuridine is an esteemed antiviral agent, boasting remarkable efficacy in studying viral infections primarily instigated by the notorious herpes viruses. Its mode of action involves impeding the replication of viral DNA, thereby showcasing its proficiency in research of afflictions such as herpes simplex virus (HSV), varicella-zoster virus (VZV) is and cytomegalovirus (CMV).
| Supplier | BOC Sciences |
|---|---|
| Product # | 58096-66-5 |
| Pricing | Inquire |
| Cas | 58096-66-5 |
| Molecular Weight | 210.19 |
| Molecular Formula | C9H10N2O4 |
| Canonical SMILES | C=C1C(CC(O1)N2C=CC(=O)NC2=O)O |