Neuroprotectin B
Neuroprotectin B is a cyclopeptide produced by the strain of Streptomyces sp. Q27107. It has the function of protecting chicken brain neuron culture from excitatory toxicity induced by glutamate and red alginate.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-02123 |
| Pricing | Inquire |
| Molecular Weight | 1360.76 |
| Molecular Formula | C61H45Cl6N7O17 |
| Canonical SMILES | CN1C(CC2=CC=C(C=C2)OC3=CC4=CC(=C3O)C5=CC6=C(C=C5)C(CC(C(=O)NC(C(=O)NC4C(=O)NC(C1=O)C7=CC(=C(C(=C7)Cl)O)Cl)C8=CC(=C(C(=C8)Cl)O)Cl)NC(=O)C(=O)C9=CC(=C(C(=C9)Cl)O)Cl)(C(=O)N6)O)C(=O)NC(C1=CC=C(C=C1)O)C(=O)O |