UNA-C(Ac)-CE Phosphoramidite

UNA-C(Ac)-CE Phosphoramidite is a compound employed in the chemical synthesis of nucleic acids, specifically in RNA synthesis. It features a UNA (Unlocked Nucleic Acid) modification, denoted by "UNA," which alters the structure and properties of the nucleotide. The "C(Ac)" indicates the nucleotide base cytosine (C) with an acetyl (Ac) group attached, potentially impacting base pairing and stability. Additionally, "CE" denotes cyanoethyl, a protecting group for the phosphate moiety, and "Phosphoramidite" refers to the reactive form of the nucleotide used in automated oligonucleotide synthesis. This compound facilitates controlled addition of modified nucleotides during RNA synthesis for various research and biotechnological applications.
Supplier BOC Sciences
Product # BRP-00431
Pricing Inquire
Cas 1120329-56-7
Molecular Weight 893.96
Molecular Formula C48H56N5O10P
Canonical SMILES CC(C)N(C(C)C)P(OCCC#N)OCC(COC(C1=CC=CC=C1)(C2=CC=C(C=C2)OC)C3=CC=C(C=C3)OC)OC(COC(=O)C4=CC=CC=C4)N5C=CC(=NC5=O)NC(=O)C
Feedback