1,3,4,6-Tetra-O-acetyl-b-D-glucosamine HCl
1,3,4,6-Tetra-O-acetyl-b-D-glucosamine HCl - a chemical compound known for its numerous therapeutic applications, including the development of drugs for osteoarthritis, rheumatoid arthritis, and autoimmune diseases. Of particular interest is its use in biomedicine, where it has proven invaluable in the preparation of glycan arrays - crucial tools for the study of glycobiology and drug discovery. Its multifaceted properties make it a promising candidate for further research and exploration.
| Supplier | BOC Sciences |
|---|---|
| Product # | 10034-20-5 |
| Pricing | Inquire |
| Cas | 10034-20-5 |
| Molecular Weight | 383.78 |
| Molecular Formula | C14H21NO9.HCl |
| Canonical SMILES | CC(=O)OCC1C(C(C(C(O1)OC(=O)C)N)OC(=O)C)OC(=O)C.Cl |