4-FLUOROBENZYLZINC CHLORIDE
4-FLUOROBENZYLZINC CHLORIDE is a remarkable chemical compound extensively employed in comprehensive biomedical studies and stands as a burgeoning prospect for combating intricate neurological disorders and diverse cancer manifestations. Distinguished by its unprecedented attributes, this compound efficaciously facilitates the precise administration of medicinal agents, thus significantly promoting the progression of pioneering therapeutic modalities.
| Supplier | BOC Sciences |
|---|---|
| Product # | 312693-07-5 |
| Pricing | Inquire |
| Cas | 312693-07-5 |
| Molecular Weight | 209.96 |
| Molecular Formula | C7H6ClFZn |
| Canonical SMILES | [CH2-]C1=CC=C(C=C1)F.[Cl-].[Zn+2] |