4-Cyclopropylphenylboronic Acid
4-Cyclopropylphenylboronic Acid (CAS# 302333-80-8) is an intermediate used to prepare substituted indoles as PPAR-γ binding agents. It is also used in the synthesis of thienopyrimidine bisphosphonate inhibitors of farnesyl pyrophosphate synthase for potential bone resorption treatment.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB020494 |
| Pricing | Inquire |
| Cas | 302333-80-8 |
| Molecular Weight | 161.99 |
| Molecular Formula | C9H11O2B |
| Canonical SMILES | B(C1=CC=C(C=C1)C2CC2)(O)O |